|
|
| | 4'-ETHYL-4-BIPHENYLBORONIC ACID Basic information |
| Product Name: | 4'-ETHYL-4-BIPHENYLBORONIC ACID | | Synonyms: | 4'-ETHYL-4-BIPHENYLBORONIC ACID;[4-(4-Ethylphenyl)phenyl]boronic acid;B-(4'-ethyl[1,1'-biphenyl]-4-yl)Boronic acid;(4'-Ethyl[1,1'-biphenyl]-4-yl)-boronic acid;Boronic acid, B-(4'-ethyl[1,1'-biphenyl]-4-yl)-;4'-Ethyl-4-biphenylboronic acid (contains varying amounts of Anhydride）;4'-ethyl-4-biphenylboronic.;(4'-Ethyl-[1,1'-biphenyl]-4-yl)boronic acid | | CAS: | 153035-62-2 | | MF: | C14H15BO2 | | MW: | 226.08 | | EINECS: | | | Product Categories: | | | Mol File: | 153035-62-2.mol |  |
| | 4'-ETHYL-4-BIPHENYLBORONIC ACID Chemical Properties |
| Boiling point | 401.8±48.0 °C(Predicted) | | density | 1.13 | | storage temp. | Inert atmosphere,2-8°C | | pka | 8.61±0.17(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H15BO2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(16)17/h3-10,16-17H,2H2,1H3 | | InChIKey | DEUOTLGHQXNPJY-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C2=CC=C(CC)C=C2)C=C1)(O)O |
| | 4'-ETHYL-4-BIPHENYLBORONIC ACID Usage And Synthesis |
| Uses | 4''-Ethyl-4-biphenylboronic acid |
| | 4'-ETHYL-4-BIPHENYLBORONIC ACID Preparation Products And Raw materials |
|