- Nequinate
-
- $0.00 / 1kg
-
2026-03-04
- CAS:13997-19-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: Customise
- Nequinate
-
- $59.00 / 10mg
-
2026-01-30
- CAS:13997-19-8
- Min. Order:
- Purity: 96.43%
- Supply Ability: 10g
- Nequinate USP/EP/BP
-
- $1.10 / 1g
-
2025-11-18
- CAS:13997-19-8
- Min. Order: 1g
- Purity: 99.9%
- Supply Ability: 100 Tons min
|
| | Nequinate Basic information |
| Product Name: | Nequinate | | Synonyms: | 3-Quinolinecarboxylic acid, 6-butyl-1,4-dihydro-4-oxo-7-(phenylmethoxy)-, methyl ester;3-Quinolinecarboxylic acid, 7-(benzyloxy)-6-butyl-1,4-dihydro-4-oxo-, methyl ester;Mequinate;Methyl 7-(benzyloxy)-6-butyl-1,4-dihydro-4-oxo-3-quinolinecarboxylate;Methyl benzoquat;Statoquate;7-(Benzyloxy)-6-butyl-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid methyl ester;7-(Benzyloxy)-6-butyl-1,4-dihydro-4-oxoquinoline-3-carboxylic acid methyl ester | | CAS: | 13997-19-8 | | MF: | C22H23NO4 | | MW: | 365.42 | | EINECS: | 237-796-6 | | Product Categories: | | | Mol File: | 13997-19-8.mol |  |
| | Nequinate Chemical Properties |
| Melting point | 287-288° | | Boiling point | 520.7±50.0 °C(Predicted) | | density | 1.185±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acidic Methanol (Slightly, Heated, Sonicated) | | pka | 1.06±0.70(Predicted) | | color | White to Off-White | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | 1S/C22H23NO4/c1-3-4-10-16-11-17-19(23-13-18(21(17)24)22(25)26-2)12-20(16)27-14-15-8-6-5-7-9-15/h5-9,11-13H,3-4,10,14H2,1-2H3,(H,23,24) | | InChIKey | NNOPDLNHPOLRRE-UHFFFAOYSA-N | | SMILES | CCCCc1cc2C(=O)C(=CNc2cc1OCc3ccccc3)C(=O)OC | | CAS DataBase Reference | 13997-19-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29334900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4 |
| | Nequinate Usage And Synthesis |
| Chemical Properties | Crystals. | | Uses | Neqoinate, is an anticoccidial agent, preventing coccidiosis and developing immunity against five different species of Eimeria. | | Uses | Coccidiostatic Drugs of Quinolines | | Definition | ChEBI: Nequinate is a member of quinolines. | | Safety Profile | When heated to
decomposition it emits acrid smoke and
irritating fumes. | | IC 50 | Coccidia |
| | Nequinate Preparation Products And Raw materials |
|