|
|
| | 5-Bromo-2-fluoro-m-xylene Basic information |
| Product Name: | 5-Bromo-2-fluoro-m-xylene | | Synonyms: | 5-BROMO-2-FLUORO-M-XYLENE;5-BROMO-2-FLUORO-3-XYLENE;5-Bromo-2-fluoro-1,3-xylene;4-Bromo-2,6-dimethylfluorobenzene 99%;4-Bromo-2,6-dimethylfluorobenzene99%;5-Bromo-1,3-dimethyl-2-fluorobenzene 99%;5-Bromo-1,3-dimethyl-2-fluorobenzene;5-Bromo-2-fluoro-m-xylene | | CAS: | 99725-44-7 | | MF: | C8H8BrF | | MW: | 203.05 | | EINECS: | | | Product Categories: | Aromatic Halides (substituted);1 | | Mol File: | 99725-44-7.mol |  |
| | 5-Bromo-2-fluoro-m-xylene Chemical Properties |
| Boiling point | 95 °C | | density | 1,45 g/cm3 | | refractive index | 1.5270 to 1.5320 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C8H8BrF/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 | | InChIKey | ZXPHUVHMBKRRJF-UHFFFAOYSA-N | | SMILES | C1(C)=CC(Br)=CC(C)=C1F | | CAS DataBase Reference | 99725-44-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | HS Code | 2903998090 |
| Provider | Language |
|
ALFA
| English |
| | 5-Bromo-2-fluoro-m-xylene Usage And Synthesis |
| Uses | 5-Bromo-2-fluoro-m-xylene is an aromatic halide compound. Its chemical properties are mainly concentrated on the bromine atom on its benzene ring. It can be used to prepare Grignard reagents and aromatic boron compounds. In addition, this substance can undergo cross-coupling reactions with metal-organic reagents under the catalysis of transition metals and can be used to prepare polysubstituted fluorobenzene organic molecules. |
| | 5-Bromo-2-fluoro-m-xylene Preparation Products And Raw materials |
|