|
|
| | 2-(Methanesulfonylamino)phenylboronic acid Basic information |
| | 2-(Methanesulfonylamino)phenylboronic acid Chemical Properties |
| Melting point | 116-120°C | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | color | off white | | InChI | 1S/C7H10BNO4S/c1-14(12,13)9-7-5-3-2-4-6(7)8(10)11/h2-5,9-11H,1H3 | | InChIKey | RPRMOEFOTPSWBO-UHFFFAOYSA-N | | SMILES | B(O)(O)c1c(cccc1)N[S](=O)(=O)C | | CAS DataBase Reference | 756520-78-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22-36 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(Methanesulfonylamino)phenylboronic acid Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powde |
| | 2-(Methanesulfonylamino)phenylboronic acid Preparation Products And Raw materials |
|