| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Fluorochem Ltd. |
| Tel: |
+44 1457 868921 |
| Email: |
enquiries@fluorochem.co.uk |
|
| | 2-Phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid Basic information |
| | 2-Phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Melting point | 188-190 | | Boiling point | 405.7±55.0 °C(Predicted) | | density | 1.489±0.06 g/cm3(Predicted) | | pka | 1.79±0.36(Predicted) | | form | solid | | InChI | 1S/C11H6F3NO2S/c12-11(13,14)8-7(10(16)17)18-9(15-8)6-4-2-1-3-5-6/h1-5H,(H,16,17) | | InChIKey | YQIRASZRRDKWSG-UHFFFAOYSA-N | | SMILES | O=C(O)C(S1)=C(C(F)(F)F)N=C1C2=CC=CC=C2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 2-Phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| | 2-Phenyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|