|
|
| | (R,R)-2,2'-(DIMETHYLMETHYLENE)BIS(4-PHENYL-2-OXAZOLINE) Basic information |
| Product Name: | (R,R)-2,2'-(DIMETHYLMETHYLENE)BIS(4-PHENYL-2-OXAZOLINE) | | Synonyms: | (R)-(+)-2,2'-ISOPROPYLIDENEBIS(4-PHENYL-2-OXAZOLINE);(R,R)-2,2-BIS(4-PHENYL-2-OXAZOLIN-2-YL)PROPANE;(R,R)-2,2'-(DIMETHYLMETHYLENE)BIS(4-PHENYL-2-OXAZOLINE);(R,R)-2,2'-ISOPROPYLIDENEBIS(4-PHENYL-2-OXAZOLINE);(R,R)-2,2μ-Isopropylidenebis(4-phenyl-2-oxazoline), (R,R)-2,2μ-Bis(4-phenyl-2-oxazolin-2-yl)propane;(+)-2,2'-isopropylidenebis[(4r)-4-phenyl-2-oxazoline];(+)-2,2'-isopropylidenebis[(4r)-4-phenyl-2-oxazo;(R,R)-2,2'-(Dimethylmethylene)Bis(4-Phenyl-2-Oxazoline),96% | | CAS: | 150529-93-4 | | MF: | C21H22N2O2 | | MW: | 334.41 | | EINECS: | | | Product Categories: | Chiral Nitrogen;BOX series;Asymmetric Synthesis;Synthetic Organic Chemistry | | Mol File: | 150529-93-4.mol |  |
| | (R,R)-2,2'-(DIMETHYLMETHYLENE)BIS(4-PHENYL-2-OXAZOLINE) Chemical Properties |
| Melting point | 56-58 °C(lit.) | | Boiling point | 468.9±45.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | refractive index | 160 ° (C=1, EtOH) | | storage temp. | -20°C | | pka | 4.85±0.70(Predicted) | | form | clear liquid | | color | Light yellow to Amber to Dark green | | Optical Rotation | [α]20/D +160°, c = 1 in ethanol | | BRN | 4266906 | | InChI | 1S/C21H22N2O2/c1-21(2,19-22-17(13-24-19)15-9-5-3-6-10-15)20-23-18(14-25-20)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m0/s1 | | InChIKey | JTNVCJCSECAMLD-ROUUACIJSA-N | | SMILES | CC(C)(C1=N[C@@H](CO1)c2ccccc2)C3=N[C@@H](CO3)c4ccccc4 | | CAS DataBase Reference | 150529-93-4 |
| Hazard Codes | T | | Risk Statements | 23/24/25 | | Safety Statements | 26-36-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |
| | (R,R)-2,2'-(DIMETHYLMETHYLENE)BIS(4-PHENYL-2-OXAZOLINE) Usage And Synthesis |
| Chemical Properties | Low melting solid or liquid | | Uses | (+)-2,2′-Isopropylidenebis[(4R)-4-phenyl-2-oxazoline] in the presence of copper iodide, can catalyze the asymmetric cyclopropanation reaction of phenyliodonium ylides with alkenes to form cyclopropane α-amino acid esters. |
| | (R,R)-2,2'-(DIMETHYLMETHYLENE)BIS(4-PHENYL-2-OXAZOLINE) Preparation Products And Raw materials |
|