- Kinetin riboside
-
- $48.00 / 1mL
-
2026-05-11
- CAS:4338-47-0
- Min. Order:
- Purity: 99.82%
- Supply Ability: 10g
- KINETIN RIBOSIDE
-
- $7.00 / 1KG
-
2019-09-02
- CAS:4338-47-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: JD 554
|
| | KINETIN RIBOSIDE Basic information |
| | KINETIN RIBOSIDE Chemical Properties |
| Melting point | 152-154 °C | | Boiling point | 683.7±65.0 °C(Predicted) | | density | 1.78±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethanol (Slightly, Heated, Sonicated), Methanol (Very Slightly, | | form | Solid | | pka | 13.11±0.70(Predicted) | | color | White to Pale Brown | | Stability: | Hygroscopic | | InChI | 1S/C15H17N5O5/c21-5-9-11(22)12(23)15(25-9)20-7-19-10-13(17-6-18-14(10)20)16-4-8-2-1-3-24-8/h1-3,6-7,9,11-12,15,21-23H,4-5H2,(H,16,17,18)/t9-,11-,12-,15-/m1/s1 | | InChIKey | RCPMGBAAUYWYDJ-FRJWGUMJSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)NCC3=CC=CO3)N=C2)[C@H](O)[C@@H]1O | | CAS DataBase Reference | 4338-47-0 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | AU7400200 | | HS Code | 29349990 | | Storage Class | 13 - Non Combustible Solids |
| | KINETIN RIBOSIDE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Kinetin Riboside is used as an anticancer and antiviral agent. | | Definition | ChEBI: (2R,3R,4S,5R)-2-[6-(2-furanylmethylamino)-9-purinyl]-5-(hydroxymethyl)oxolane-3,4-diol is a purine nucleoside. | | Biological Activity | Kinetin riboside exhibits cytotoxic and antiproliferative activities. In addition, it also shows anticancer activity by inducing apoptosis in various types of cancers including myeloid leukemia cells, mouse melanoma B16F-10 cells, and plant tumor cells. | | in vivo | Kinetin riboside significantly suppresses tumor growth. The most effective anti-melanoma response is elicited at 40 mg/kg[2]. |
| | KINETIN RIBOSIDE Preparation Products And Raw materials |
|