|
|
| | 2-(4-TERT-BUTYL-2,6-DIMETHYL-BENZYL)-4,5-DIHYDRO-1H-IMIDAZOLE Basic information |
| Product Name: | 2-(4-TERT-BUTYL-2,6-DIMETHYL-BENZYL)-4,5-DIHYDRO-1H-IMIDAZOLE | | Synonyms: | XYLOMETAZOLINE;2-(4-TERT-BUTYL-2,6-DIMETHYL-BENZYL)-4,5-DIHYDRO-1H-IMIDAZOLE;AKOS BBS-00000259;XYLOMETAZOLINEANDITSHYDROCHLORIDE;Xylometazoline (base and/or unspecified salts);1h-imidazole,2-((4-(1,1-dimethylethyl)-2,6-dimethylphenyl)methyl)-4,5-dihydr;2-(4-tert-butyl-2,6-dimethylbenzyl)-2-imidazolin;2-(4-tert-Butyl-2,6-dimethylbenzyl)-2-imidazoline | | CAS: | 526-36-3 | | MF: | C16H24N2 | | MW: | 244.38 | | EINECS: | 208-390-6 | | Product Categories: | | | Mol File: | 526-36-3.mol |  |
| | 2-(4-TERT-BUTYL-2,6-DIMETHYL-BENZYL)-4,5-DIHYDRO-1H-IMIDAZOLE Chemical Properties |
| Melting point | 131-133° | | Boiling point | 394.2±21.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 49 mg/mL (200.51 mM);Ethanol: 49 mg/mL (200.51 mM) | | pka | pKa 10.6±0.1(H2O
t = 22.0) (Uncertain) | | Water Solubility | Water: Insoluble | | InChI | InChI=1S/C16H24N2/c1-11-8-13(16(3,4)5)9-12(2)14(11)10-15-17-6-7-18-15/h8-9H,6-7,10H2,1-5H3,(H,17,18) | | InChIKey | HUCJFAOMUPXHDK-UHFFFAOYSA-N | | SMILES | C1(CC2=C(C)C=C(C(C)(C)C)C=C2C)NCCN=1 | | CAS DataBase Reference | 526-36-3 |
| Toxicity | LD50 oral in mouse: 215mg/kg |
| | 2-(4-TERT-BUTYL-2,6-DIMETHYL-BENZYL)-4,5-DIHYDRO-1H-IMIDAZOLE Usage And Synthesis |
| Uses | Adrenergic (vasoconstrictor). | | Uses | Xylometazoline is used for rhinitis, laryngitis, sinusitis, inflammation of antrum of
Highmore, and allergic illnesses of the nasal cavity and throat. | | Definition | ChEBI: Xylometazoline is an alkylbenzene. | | Brand name | Neo-Synephrine II (Sterling Winthrop); Otrivin
Hydrochloride (Ciba-Geigy). | | Synthesis | Xylometazoline, 2-(4-tert-butyl-2,6-dimethylbenzyl)-2-imidazoline
(11.1.40), is also synthesized in a single reaction by cyclocondensation of 4-tert-butyl-2,6-
dimethylbenzylcyanide with ethylendiamine [43,44]. 
| | in vivo | Xylometazoline (1 mg/mL, intranasal, single dose) improves sinusitis in rats[3].
Xylometazoline and its excipients, when used for prolonged periods, may cause ophthalmic problems such as dry eyes, corneal edema, cataracts, retinal nerve fiber layer damage, and vascular damage[4]. | Animal Model: | SpragueDawley rat induced by platelet-activating factor[3] | | Dosage: | 1 mg/mL; single dose | | Administration: | Intranasal administration | | Result: | Showed almost no vascular congestion, little infiltration, and the epithelium was completely intact. |
| | IC 50 | Alpha-1A adrenergic receptor: 0.05 μM (Ki); Alpha-1B adrenergic receptor: 0.30 μM (Ki); Alpha-1D adrenergic receptor: 0.15 μM (Ki); Alpha-2A adrenergic receptor: 0.88 μM (Ki); Alpha-2B adrenergic receptor: 1.7 μM (Ki); Alpha-2C adrenergic receptor: 0.19 μM (Ki) |
| | 2-(4-TERT-BUTYL-2,6-DIMETHYL-BENZYL)-4,5-DIHYDRO-1H-IMIDAZOLE Preparation Products And Raw materials |
|