- 3,4-DIMETHYLTHIOPHENE
-
- $10.00 / 1KG
-
2026-03-20
- CAS:632-15-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 3,4-DIMETHYLTHIOPHENE
-
- $1.10 / 1g
-
2025-11-18
- CAS:632-15-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- 3,4-dimethylthiophene
-
- $15.00 / 1KG
-
2021-07-13
- CAS:632-15-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3,4-DIMETHYLTHIOPHENE Basic information |
| | 3,4-DIMETHYLTHIOPHENE Chemical Properties |
| Melting point | 50-54℃ | | Boiling point | 147℃ | | density | 1.006 | | FEMA | 4645 | 3,4-DIMETHYLTHIOPHENE | | refractive index | 1.5187 | | Fp | >110℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | liquid (estimate) | | Appearance | Colorless to light yellow Liquid | | Odor | savory roasted onion | | JECFA Number | 2110 | | InChI | InChI=1S/C6H8S/c1-5-3-7-4-6(5)2/h3-4H,1-2H3 | | InChIKey | GPSFYJDZKSRMKZ-UHFFFAOYSA-N | | SMILES | C1SC=C(C)C=1C | | LogP | 2.82 |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | RIDADR | 1993 | | HazardClass | 3 | | PackingGroup | Ⅲ | | HS Code | 2934999090 |
| | 3,4-DIMETHYLTHIOPHENE Usage And Synthesis |
| Uses | 3,4-Dimethylthiophene is used in dry onion preparation for seasoning. | | Definition | ChEBI: 3,4-dimethylthiophene is a thiophene that is substituted by methyl groups at positions 3 and 4. It has a role as a flavouring agent, a plant metabolite and a human urinary metabolite. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 27, p. 869, 1962 DOI: 10.1021/jo01050a043 |
| | 3,4-DIMETHYLTHIOPHENE Preparation Products And Raw materials |
|