- 3,4-DIMETHYLTHIOPHENE
-
- $1.10
-
2026-08-20
- CAS:632-15-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | 3,4-Dimethylthiophene Basic information | | Synthesis |
| | 3,4-Dimethylthiophene Chemical Properties |
| Melting point | 50-54℃ | | Boiling point | 147℃ | | density | 1.006 | | refractive index | 1.5187 | | FEMA | 4645 | 3,4-DIMETHYLTHIOPHENE | | Fp | >110℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | liquid (estimate) | | Odor | savory roasted onion | | Appearance | Colorless to light yellow Liquid | | JECFA Number | 2110 | | Henry's Law Constant | 1.5×10-3 mol/(m3Pa) at 25℃, Yaws et al. (2003) | | InChI | InChI=1S/C6H8S/c1-5-3-7-4-6(5)2/h3-4H,1-2H3 | | InChIKey | GPSFYJDZKSRMKZ-UHFFFAOYSA-N | | SMILES | C1SC=C(C)C=1C | | LogP | 2.82 |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | RIDADR | 1993 | | HazardClass | 3 | | PackingGroup | Ⅲ | | HS Code | 2934999090 |
| | 3,4-Dimethylthiophene Usage And Synthesis |
| Synthesis | 3,4-Dimethylthiophene can be prepared from tetraethoxycarbonylethane and dichloromethyl sulfide. The ester is reduced with LAH to give a diol, and the diacetate is directly pyrolyzed to give 3,4-dimethylthiophene. 
| | Uses | 3,4-Dimethylthiophene is used in dry onion preparation for seasoning. | | Definition | ChEBI: 3,4-dimethylthiophene is a thiophene that is substituted by methyl groups at positions 3 and 4. It has a role as a flavouring agent, a plant metabolite and a human urinary metabolite. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 27, p. 869, 1962 DOI: 10.1021/jo01050a043 |
| | 3,4-Dimethylthiophene Preparation Products And Raw materials |
|