|
|
| | 1,3-Bis(1-adamantyl)imidazolium tetrafluoroborate Basic information |
| Product Name: | 1,3-Bis(1-adamantyl)imidazolium tetrafluoroborate | | Synonyms: | N,N'-(ADAMANTYL)DIHYDROIMIDAZOLIUM TETRAFLUOROBORATE;N,N'-(ADAMANTYL)IMIDAZOLIUM TETRAFLUOROBORATE;1,3-DIADAMANTYL-IMIDAZOLIUM TETRAFLUOROBORATE;1,3-BIS(1-ADAMANTYL)IMIDAZOLINIUM TETRAFLUOROBORATE;1,3-BIS(1-ADAMANTYL)IMIDAZOLIUM TETRAFLUOROBORATE;1,3-BIS(TRICYCLO[3.3.1.1(3,7)]DEC-1-YL)-1H-IMIDAZOLIUM TETRAFLUOROBORATE;1,3-BIS(1-ADAMANTYL)IMIDAZOLIUM TETRAFL&;1,3-Di(1-adamantyl)imidazolium Tetrafluoroborate | | CAS: | 286014-42-4 | | MF: | C23H33BF4N2 | | MW: | 424.33 | | EINECS: | | | Product Categories: | Achiral Nitrogen;NHC;B (Classes of Boron Compounds);Imidazolium Compounds;Ligands;N-Heterocyclic Carbene Ligands;Synthetic Organic Chemistry;Tetrafluoroborates | | Mol File: | 286014-42-4.mol |  |
| | 1,3-Bis(1-adamantyl)imidazolium tetrafluoroborate Chemical Properties |
| Melting point | 277-282 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | Powder | | color | White to pale brown | | InChIKey | KVWCCJYLKCSVME-SVFMDKMYSA-N | | SMILES | [N+]1([C@]23C[C@@]4([H])C[C@]([H])(C[C@@](C4)([H])C2)C3)C=CN(C=1)[C@@]12C[C@]3([H])C[C@@]([H])(C[C@](C3)([H])C1)C2.[B-](F)(F)(F)F |&1:1,3,6,9,18,20,23,26,r| | | CAS DataBase Reference | 286014-42-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1759 | | WGK Germany | 3 | | HS Code | 2933.29.9000 | | HazardClass | 8 | | PackingGroup | III |
| | 1,3-Bis(1-adamantyl)imidazolium tetrafluoroborate Usage And Synthesis |
| | 1,3-Bis(1-adamantyl)imidazolium tetrafluoroborate Preparation Products And Raw materials |
|