3-Pyridylacetic acid manufacturers
- 3-Pyridylacetic acid
-
- $0.00 / 1KG
-
2022-02-19
- CAS:501-81-5
- Min. Order: 1KG
- Purity: 97.7%
- Supply Ability: 100 tons
- 3-Pyridylacetic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:501-81-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3-Pyridylacetic acid Basic information |
| | 3-Pyridylacetic acid Chemical Properties |
| Melting point | 144-146°C | | Boiling point | 301.6±17.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in DMSO | | pka | 3.59±0.10(Predicted) | | form | crystalline solid | | color | White to off-white | | InChI | InChI=1S/C7H7NO2/c9-7(10)4-6-2-1-3-8-5-6/h1-3,5H,4H2,(H,9,10) | | InChIKey | WGNUNYPERJMVRM-UHFFFAOYSA-N | | SMILES | C1=NC=CC=C1CC(O)=O | | CAS DataBase Reference | 501-81-5(CAS DataBase Reference) | | EPA Substance Registry System | 3-Pyridineacetic acid (501-81-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29339900 |
| | 3-Pyridylacetic acid Usage And Synthesis |
| Chemical Properties | Off-white to light yellow solid | | Definition | ChEBI: A monocarboxylic acid that is acetic acid substituted by a (pyridin-3-yl) group. It is a metabolite of nicotine and other tobacco alkaloids. | | Synthesis | (1) 2-(pyridin-3-yl)acetic acid hydrochloride (13.2 g, 75.6 mmol) was suspended in ethanol (100 mL) and an ethanol solution of 0.5 mol/L potassium hydroxide (150 mL) was slowly added. The reaction mixture was stirred until homogeneous and then filtered to remove the resulting potassium chloride precipitate. The filtrate was concentrated and dried to give 2-(pyridin-3-yl)acetic acid (10.6 g, quantitative yield). | | References | [1] Patent: EP1559716, 2005, A1. Location in patent: Page/Page column 20 |
| | 3-Pyridylacetic acid Preparation Products And Raw materials |
|