|
|
| | 1H,1H,2H,2H-PERFLUOROOCTANETHIOL Basic information | | Uses |
| Product Name: | 1H,1H,2H,2H-PERFLUOROOCTANETHIOL | | Synonyms: | 1H,1H,2H,2H-PERFLUOROOCTANE-1-THIOL;1H,1H,2H,2H-PERFLUOROOCTANETHIOL;1H,1H,2H,2H-PERFLUOROOCTYL-1-THIOL;3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanethiol;3 3 4 4 5 5 6 6 7 7 8 8 8-TRIDECAFLUORO-;1H,1H,2H,2H-Perfluorooctyl mercaptan, 1H,1H,2H,2H-Perfluoro-1-octanethiol;1H,1H,2H,2H-Perfluoro-1-octanethiol;1H,1H,2H,2H-Perfluoroalkyl Thiol | | CAS: | 34451-26-8 | | MF: | C8H5F13S | | MW: | 380.17 | | EINECS: | 628-448-8 | | Product Categories: | | | Mol File: | 34451-26-8.mol |  |
| | 1H,1H,2H,2H-PERFLUOROOCTANETHIOL Chemical Properties |
| Boiling point | 58 °C | | density | 1.62 | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform, Methanol | | pka | 9.59±0.10(Predicted) | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C8H5F13S/c9-3(10,1-2-22)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h22H,1-2H2 | | InChIKey | GTPHVVCYEWPQFE-UHFFFAOYSA-N | | SMILES | C(S)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | LogP | 5.3 at pH7 | | EPA Substance Registry System | 2-(Perfluorohexyl)ethanethiol (34451-26-8) |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36-26 | | RIDADR | UN 3334 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 2930909899 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1H,1H,2H,2H-PERFLUOROOCTANETHIOL Usage And Synthesis |
| Uses | 1H,1H,2H,2H-Perfluorooctyl-1-thiol acts as a reagent in the preparation, structure, and antitumor activity of dinuclear arene ruthenium thiolato complexes with fluorous side-chains. Reagent in the preparation of glycolipidic nitrones as potential antioxidant drugs for neurodegenerative disorders. | | Uses | 1H,1H,2H,2H-Perfluorooctyl-1-thiol acts as a reagent in the preparation, structure, and antitumor activity of dinuclear arene ruthenium thiolato complexes with fluorous side-chains. Reagent in the preparation of glycolipidic nitrones as potential antioxidant drugs for neurodegenerative disorders. |
| | 1H,1H,2H,2H-PERFLUOROOCTANETHIOL Preparation Products And Raw materials |
| Raw materials | Disulfide, bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-->Thiocyanic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester-->1H,1H,2H,2H-Perfluorooctyl iodide | | Preparation Products | 1H,1H,2H,2H-Perfluorooctanesulfonic acid |
|