|
|
| | 2-Amino-4-chloro-6-nitrophenol Basic information |
| | 2-Amino-4-chloro-6-nitrophenol Chemical Properties |
| Melting point | 158-162 °C (lit.) | | Boiling point | 308.3±42.0 °C(Predicted) | | density | 1.655±0.06 g/cm3(Predicted) | | solubility | soluble in Acetone | | pka | 6.06±0.38(Predicted) | | form | Powder | | color | Dark red to brown | | InChI | 1S/C6H5ClN2O3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H,8H2 | | InChIKey | MHAFRUMLQZZSIN-UHFFFAOYSA-N | | SMILES | Nc1cc(Cl)cc(c1O)[N+]([O-])=O | | CAS DataBase Reference | 6358-08-3(CAS DataBase Reference) | | EPA Substance Registry System | 2-Amino-4-chloro-6-nitrophenol (6358-08-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | HazardClass | 6.1 | | HS Code | 29222990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-4-chloro-6-nitrophenol Usage And Synthesis |
| Chemical Properties | Red Solid | | Uses | Intermediate in the preparation of antipsychotics | | General Description | A solid. | | Air & Water Reactions | May be sensitive to air and/or light. | | Reactivity Profile | 2-Amino-4-chloro-6-nitrophenol may react with strong oxidizing agents . | | Fire Hazard | Flash point data for 2-Amino-4-chloro-6-nitrophenol are not available. 2-Amino-4-chloro-6-nitrophenol is probably combustible. |
| | 2-Amino-4-chloro-6-nitrophenol Preparation Products And Raw materials |
|