| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | L-Proline-13C5,15N Basic information |
| Product Name: | L-Proline-13C5,15N | | Synonyms: | L-Proline-13C5,15N 98 atom % 13C, 98 atom % 15N, 95% (CP);L-Proline-13C?,1?N;L-PROLINE-13C5,15N;L-Proline-carboxy,2,3,4,5-13C5-1-15N;L-Proline-13C5,15N;L-Proline-13 C 5 , 15 N (Standard) | | CAS: | 202407-23-6 | | MF: | C5H9NO2 | | MW: | 121.09 | | EINECS: | | | Product Categories: | | | Mol File: | 202407-23-6.mol |  |
| | L-Proline-13C5,15N Chemical Properties |
| Melting point | 228 °C (dec.) (lit.) | | density | 1.187±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]25/D -86.0°, c =2 in H2O | | InChI | 1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | ONIBWKKTOPOVIA-XAFSXMPTSA-N | | SMILES | O[13C](=O)[13C@@H]1[13CH2][13CH2][13CH2][15NH]1 | | CAS Number Unlabeled | 147-85-3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Proline-13C5,15N Usage And Synthesis |
| Uses | L-Proline-13C5,1-15N is the 13C- and 15N-labeled L-Proline. L-Proline is one of the twenty amino acids used in living organisms as the building blocks of proteins. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Proline-13C5,15N Preparation Products And Raw materials |
|