| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | Piperazine, 1-[(2,6-difluorophenyl)sulfonyl]-4-[(2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]- Basic information |
| | Piperazine, 1-[(2,6-difluorophenyl)sulfonyl]-4-[(2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]- Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: 50mg/mL | | form | powder | | color | white | | InChI | 1S/C18H18F2N2O6S2/c19-14-2-1-3-15(20)18(14)30(25,26)22-8-6-21(7-9-22)29(23,24)13-4-5-16-17(12-13)28-11-10-27-16/h1-5,12H,6-11H2 | | InChIKey | SHWNKRPMUBFWKE-UHFFFAOYSA-N | | SMILES | FC(C=CC=C1F)=C1S(N2CCN(S(C3=CC4=C(OCCO4)C=C3)(=O)=O)CC2)(=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Piperazine, 1-[(2,6-difluorophenyl)sulfonyl]-4-[(2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]- Usage And Synthesis |
| Uses | A cell-permeable diarylsulfonamide (DASA) compound that acts as a potent and selective activator of tumor-specific M2 isozyme of pyruvate kinase (PKM2; AC50 = 65 nM). Pretreatment of A549 (adenocarcinomic human alveolar basal epithelial cells) with DASA-10 (~10 µM) prevents hydrogen peroxide, diamide, and hypoxia-induced inactivation of PKM2. DASA treatment is shown to cause a diminution in cellular glutathione levels, and higher oxidative stress-induced cell death. | | Definition | ChEBI: 1-(2,6-difluorophenyl)sulfonyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine is a sulfonamide. |
| | Piperazine, 1-[(2,6-difluorophenyl)sulfonyl]-4-[(2,3-dihydro-1,4-benzodioxin-6-yl)sulfonyl]- Preparation Products And Raw materials |
|