|
|
| | Pyrimidine, 4-chloro-6-cyclopropyl-2-(methylsulfonyl)- Basic information |
| | Pyrimidine, 4-chloro-6-cyclopropyl-2-(methylsulfonyl)- Chemical Properties |
| form | solid | | InChI | 1S/C8H9ClN2O2S/c1-14(12,13)8-10-6(5-2-3-5)4-7(9)11-8/h4-5H,2-3H2,1H3 | | InChIKey | LORZEFKKDWOTCQ-UHFFFAOYSA-N | | SMILES | O=S(C)(C1=NC(C2CC2)=CC(Cl)=N1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | Pyrimidine, 4-chloro-6-cyclopropyl-2-(methylsulfonyl)- Usage And Synthesis |
| | Pyrimidine, 4-chloro-6-cyclopropyl-2-(methylsulfonyl)- Preparation Products And Raw materials |
|