| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd. Gold
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:3-Bromo-1-methyl-1H-1,2,4-triazol-5-amine
CAS:1365957-74-9
Purity:98%
|
| Company Name: |
Shanghai Pleikon Chemical Technology Co., Ltd
|
| Tel: |
021-54321516 17717324060 |
| Email: |
2719672468@qq.com |
| Products Intro: |
Product Name:3-bromo-1-methyl-1H-1,2,4-triazol-5-amine
CAS:1365957-74-9
Purity:95% HPLC Package:5G;;10g;25g
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-1647117 13681763483 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:3-Bromo-1-methyl-1H-1,2,4-triazol-5-amine
CAS:1365957-74-9
Purity:95% Package:100mg;250mg;1g Remarks:BD00999656
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-6005915 |
| Email: |
sales@picasso-e.com |
| Products Intro: |
Product Name:3-Bromo-1-methyl-1H-1,2,4-triazol-5-amine
CAS:1365957-74-9
Purity:95% Package:100mg;250mg;1g
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-025-66113011 15955137747 |
| Email: |
cb5@aikonchem.com |
| Products Intro: |
Product Name:1H-1,2,4-Triazol-5-amine, 3-bromo-1-methyl-
CAS:1365957-74-9
Purity:95% Package:1g;5g;10g
|
|
| | 1H-1,2,4-Triazol-5-amine, 3-bromo-1-methyl- Basic information |
| | 1H-1,2,4-Triazol-5-amine, 3-bromo-1-methyl- Chemical Properties |
| Boiling point | 352.0±25.0 °C(Predicted) | | density | 2.19±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 1.79±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C3H5BrN4/c1-8-3(5)6-2(4)7-8/h1H3,(H2,5,6,7) | | InChIKey | KXUVBUJQRLQSMU-UHFFFAOYSA-N | | SMILES | N1(C)C(N)=NC(Br)=N1 |
| | 1H-1,2,4-Triazol-5-amine, 3-bromo-1-methyl- Usage And Synthesis |
| | 1H-1,2,4-Triazol-5-amine, 3-bromo-1-methyl- Preparation Products And Raw materials |
|