| Company Name: |
Shanghai Chenzhu Pharmaceutical Co., Ltd. Gold
|
| Tel: |
13162380607 |
| Email: |
1696175688@qq.com |
| Products Intro: |
Product Name: 2-METHYL-OXAZOLO[4,5-C]PYRIDINE CAS:78998-29-5 Purity:96%HPLC Package:1g;5g;10g;50g;100g;500g;1kg Remarks:in store
|
|
| | 2-METHYL-OXAZOLO[4,5-C]PYRIDINE Basic information |
| | 2-METHYL-OXAZOLO[4,5-C]PYRIDINE Chemical Properties |
| Melting point | 47-50℃ | | Boiling point | 232℃ | | density | 1.229 | | Fp | 99℃ | | storage temp. | 2-8°C | | pka | 1.55±0.50(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H6N2O/c1-5-9-6-4-8-3-2-7(6)10-5/h2-4H,1H3 | | InChIKey | MNEWMWOJTJIXFU-UHFFFAOYSA-N | | SMILES | C1=NC=CC2OC(C)=NC1=2 |
| | 2-METHYL-OXAZOLO[4,5-C]PYRIDINE Usage And Synthesis |
| | 2-METHYL-OXAZOLO[4,5-C]PYRIDINE Preparation Products And Raw materials |
|