|
|
| | Aniline sulfate Basic information |
| | Aniline sulfate Chemical Properties |
| density | 1.38 | | solubility | water: soluble5%, clear, colorless | | form | powder | | color | Nearly white | | Water Solubility | Soluble in water | | BRN | 3729533 | | InChI | 1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4) | | InChIKey | FUKMEFZGEMVGLD-UHFFFAOYSA-N | | SMILES | OS(O)(=O)=O.Nc1ccccc1.Nc2ccccc2 | | CAS DataBase Reference | 542-16-5(CAS DataBase Reference) | | EPA Substance Registry System | Aniline sulfate (542-16-5) |
| Hazard Codes | T,N | | Risk Statements | 23/24/25-40-41-43-48/23/24/25-50-68 | | Safety Statements | 26-27-36/37/39-45-61-63 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Toxic | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Eye Dam. 1
Muta. 2
Skin Sens. 1
STOT RE 1 |
| | Aniline sulfate Usage And Synthesis |
| Chemical Properties | WHITE TO VERY SLIGHTLY YELLOW CRYSTALLINE POWDER | | Uses | Aniline sulfate was used as an internal standard in the stereoselective disposition of methamphetamine (MAP, a widely abused drug) study. |
| | Aniline sulfate Preparation Products And Raw materials |
|