|
|
| | (5R,6S)-5,6-Diphenyl-2-morpholinone Basic information | | Uses |
| Product Name: | (5R,6S)-5,6-Diphenyl-2-morpholinone | | Synonyms: | (5R,6S)-2,3,5,6-tetrahydro-5,6- diphenyl-1,4-oxazin;5R,6S-Diphenyl-2-morpholinone;2-Morpholinone, 5,6-diphenyl-, (5R,6S)-;(2S,3R)-2,3,5,6-tetrahydro-2,3-diphenyl-1,4-oxazin-6-one;(5R,6S)-Diphenyl-2-morpholinone,99%e.e.;HDM-01;(5R,6S)-5,6-Diphenyl-2-morpholinone;(5R,6S)-5,6-Diphenyl-2-morpholine | | CAS: | 282735-66-4 | | MF: | C16H15NO2 | | MW: | 253.3 | | EINECS: | | | Product Categories: | API intermediates;Chiral Reagents;Heterocycles | | Mol File: | 282735-66-4.mol |  |
| | (5R,6S)-5,6-Diphenyl-2-morpholinone Chemical Properties |
| Melting point | 139-141 °C(Solv: ethyl acetate (141-78-6); hexane (110-54-3)) | | Boiling point | 444.0±45.0 °C(Predicted) | | density | 1.159±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Solid | | pka | 5.68±0.60(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H15NO2/c18-14-11-17-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-10,15-17H,11H2/t15-,16+/m1/s1 | | InChIKey | LTPOSIZJPSDSIL-CVEARBPZSA-N | | SMILES | N1[C@H](C2=CC=CC=C2)[C@H](C2=CC=CC=C2)OC(=O)C1 | | CAS DataBase Reference | 282735-66-4 |
| | (5R,6S)-5,6-Diphenyl-2-morpholinone Usage And Synthesis |
| Uses | (5R,6S)-5,6-diphenylmorpholin-2-one is a morpholino derivative with pharmacological activities such as lowering cholesterol, anti-hyperlipidemia, treating arteriosclerosis, and anti-inflammation. It can be used as a pharmaceutical intermediate. |
| | (5R,6S)-5,6-Diphenyl-2-morpholinone Preparation Products And Raw materials |
| Preparation Products | (3S,3'S,4'R,6'R,8'S,8'aR)-6-chloro-8'-(3-chloro-2-fluorophenyl)-6'-(2,2-dimethylpropyl)-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-1',2-dione |
|