|
|
| | Diethylaminopropyne formate Basic information |
| Product Name: | Diethylaminopropyne formate | | Synonyms: | 3-N,N-Diethylamino-1-propyne formate;Diethylamino-2-propyne, sulfate;PABS;diethylaminopropyne formate;DIETHYLAMINOPROPYNE FORMIC ACID;DiethylaMinopropyne forMate (PABS);PABS(DiethylaMinopropyne forMate);PABS(Diethylamino-2-propyne, sulfate) | | CAS: | 125678-52-6 | | MF: | C8H15NO2 | | MW: | 157.21 | | EINECS: | | | Product Categories: | | | Mol File: | 125678-52-6.mol |  |
| | Diethylaminopropyne formate Chemical Properties |
| density | 1.04 | | refractive index | 1.4190-1.4320 | | storage temp. | Stored in cool and dry place | | form | Liquid | | color | Yellowish to brownish yellow | | PH | 4.0~5.0 | | Water Solubility | Well soluble in water (20oC) | | InChI | InChI=1S/C7H13N.CH2O2/c1-4-7-8(5-2)6-3;2-1-3/h1H,5-7H2,2-3H3;1H,(H,2,3) | | InChIKey | FZMMJXJELVVLLB-UHFFFAOYSA-N | | SMILES | C(#C)CN(CC)CC.C(O)=O |
| | Diethylaminopropyne formate Usage And Synthesis |
| Uses | Diethylaminopropyne formate(PABS) can be used as an intermediate of electroplating additive to prepare nickel plating brightening agent. |
| | Diethylaminopropyne formate Preparation Products And Raw materials |
|