|
|
| | 1-[[(4-Aminophenyl)methyl]sulfonyl]-pyrrolidine Basic information |
| | 1-[[(4-Aminophenyl)methyl]sulfonyl]-pyrrolidine Chemical Properties |
| Melting point | 170-176°C | | Boiling point | 434.2±47.0 °C(Predicted) | | density | 1.31 | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 4.35±0.10(Predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C11H16N2O2S/c12-11-5-3-10(4-6-11)9-16(14,15)13-7-1-2-8-13/h3-6H,1-2,7-9,12H2 | | InChIKey | VNSKHALYBQZMFW-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(CS(N2CCCC2)(=O)=O)C=C1 | | CAS DataBase Reference | 334981-10-1(CAS DataBase Reference) |
| | 1-[[(4-Aminophenyl)methyl]sulfonyl]-pyrrolidine Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Intermediate in the preparation of Almotriptan. |
| | 1-[[(4-Aminophenyl)methyl]sulfonyl]-pyrrolidine Preparation Products And Raw materials |
|