- Methylcyanocarbamate
-
- $10.00 / 1KG
-
2026-01-29
- CAS:21729-98-6
- Min. Order: 100KG
- Purity: 99%
- Supply Ability: 100 mt
- Methylcyanocarbamate
-
- $0.00 / 25KG
-
2025-12-01
- CAS:21729-98-6
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- Methylcyanocarbamate
-
- $0.00 / 1KG
-
2025-06-27
- CAS:21729-98-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Methylcyanocarbamate Basic information |
| Product Name: | Methylcyanocarbamate | | Synonyms: | Methyl cyanocarbamate;Methylcyanocarbamate;METHYL CYANAMIDO FORMATE;cyano-carbamic acid methyl ester;N-cyanocarbamic acid methyl ester;Methyl N-cyanocarbamate;Methoxycarbonylcyanamide;Carbamic acid, N-cyano-, methyl ester | | CAS: | 21729-98-6 | | MF: | C3H4N2O2 | | MW: | 100.08 | | EINECS: | 244-548-0 | | Product Categories: | | | Mol File: | 21729-98-6.mol |  |
| | Methylcyanocarbamate Chemical Properties |
| density | 1.272 g/cm3 | | storage temp. | Store at room temperature | | pka | 4.24±0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C3H4N2O2/c1-7-3(6)5-2-4/h1H3,(H,5,6) | | InChIKey | ZSYJMXLJNPEAGP-UHFFFAOYSA-N | | SMILES | C(OC)(=O)NC#N | | CAS DataBase Reference | 21729-98-6 | | EPA Substance Registry System | Methyl cyanocarbamate (21729-98-6) |
| | Methylcyanocarbamate Usage And Synthesis |
| Chemical Properties | Methyl cyanocarbamate calcium salt [Ca2+ + (NCN-—COOCH3)2] reacts with acid to form methyl cyanocarbamate, which is unstable to heat. | | Uses | Methylcyanocarbamate is an impurity of Albendazole (A511610), an anthelmintic drug. (Albendazole Impurity 7) |
| | Methylcyanocarbamate Preparation Products And Raw materials |
|