|
|
| | hexamethylenediammonium dibromide Basic information |
| Product Name: | hexamethylenediammonium dibromide | | Synonyms: | hexamethylenediammonium dibromide;C6H18N2Br2(HDADBr);hexane-1,6-diammonium dibromide;1,6-Hexanedi
ammonium Bromide;1,6–Hexanediammonium dibromide;HDADBr;hexamethylenediamine dibromide;Hexane-1,6-diammonium bromide | | CAS: | 24731-81-5 | | MF: | C6H18Br2N2 | | MW: | 278.02852 | | EINECS: | 246-439-3 | | Product Categories: | | | Mol File: | 24731-81-5.mol |  |
| | hexamethylenediammonium dibromide Chemical Properties |
| form | powder | | color | white | | InChI | 1S/C6H16N2.2BrH/c7-5-3-1-2-4-6-8;;/h1-8H2;2*1H | | InChIKey | XSYPBULLQGGYPJ-UHFFFAOYSA-N | | SMILES | [Br-].[Br-].[N+H3]CCCCCC[N+H3] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | hexamethylenediammonium dibromide Usage And Synthesis |
| Uses | Organohalide based perovskites have emerged as an important class of material for solar cell applications. The variations/substitution in organohalide cations and anions is employed for the optimization of the band gap, carrier diffusion length, and power conversion efficiency of perovskites based solar cells. |
| | hexamethylenediammonium dibromide Preparation Products And Raw materials |
|