- Desacetyl Bisacodyl
-
- $0.00 / 1g
-
2026-02-02
- CAS:603-41-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 2000tons
|
| | p,p'-(2-pyridylmethylene)bisphenol Basic information |
| | p,p'-(2-pyridylmethylene)bisphenol Chemical Properties |
| Melting point | >200°C (dec.) | | Boiling point | 462.1±40.0 °C(Predicted) | | density | 1.244±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2)(1:8): 0.11 mg/ml; Ethanol: 2.5 mg/ml | | form | A crystalline solid | | pka | 9.71±0.10(Predicted) | | color | White to off-white | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C18H15NO2/c20-15-8-4-13(5-9-15)18(17-3-1-2-12-19-17)14-6-10-16(21)11-7-14/h1-12,18,20-21H | | InChIKey | LJROKJGQSPMTKB-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)C1=NC=CC=C1 | | LogP | 2.31 at 22℃ and pH7 |
| WGK Germany | WGK 2 | | HS Code | 2933399090 | | Storage Class | 11 - Combustible Solids |
| | p,p'-(2-pyridylmethylene)bisphenol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | The active form of Bisacodyl. Cathartic. |
| | p,p'-(2-pyridylmethylene)bisphenol Preparation Products And Raw materials |
|