- 4-azidobenzaldehyde
-
- $8.86
-
2020-03-16
- CAS: 24173-36-2
- Min. Order: 1KG
- Purity: 95.0%-99.0%
- Supply Ability: 1kg-100kg
|
| | p-azidobenzaldehyde Basic information |
| | p-azidobenzaldehyde Chemical Properties |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Light Yellow to Yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C7H5N3O/c8-10-9-7-3-1-6(5-11)2-4-7/h1-5H | | InChIKey | SDJOUGYEUFYPLL-UHFFFAOYSA-N | | SMILES | N(C1C=CC(C=O)=CC=1)=[N+]=[N-] | | EPA Substance Registry System | Benzaldehyde, 4-azido- (24173-36-2) |
| | p-azidobenzaldehyde Usage And Synthesis |
| Uses | p-azidobenzaldehyde is used in the synthesis of fullerenes, and photocrosslinkable chitosans. |
| | p-azidobenzaldehyde Preparation Products And Raw materials |
|