|
|
| | 3-acetyl-3-chlorodihydrofuran-2(3H)-one Basic information |
| | 3-acetyl-3-chlorodihydrofuran-2(3H)-one Chemical Properties |
| Melting point | 2.2-3.0 °C | | Boiling point | 54-55 °C(Press: 0.1 Torr) | | density | 1.325 g/cm3(Temp: 15 °C) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Orange | | InChI | InChI=1S/C6H7ClO3/c1-4(8)6(7)2-3-10-5(6)9/h2-3H2,1H3 | | InChIKey | CYCRRRIREKXQTK-UHFFFAOYSA-N | | SMILES | O1CCC(C(C)=O)(Cl)C1=O |
| | 3-acetyl-3-chlorodihydrofuran-2(3H)-one Usage And Synthesis |
| Chemical Properties | Pale Brown Liquid | | Uses | 3-Acetyl-3-chlorodihydrofuranone-13C4 is a labeled analog of 3-Acetyl3-chlorodihydrofuranone (A172030), which is a useful research compound. It is an intermediate in the synthesis of 4-Methyl-5-thiazoleethanol-13C3 (M330237) is used in the synthesis of novel HldE kinase inhibitors used against gram negative bacteria. Also used in the synthesis of potential antimalarial agents from bis-thiazolium analogues. Refer to M330235. |
| | 3-acetyl-3-chlorodihydrofuran-2(3H)-one Preparation Products And Raw materials |
|