| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | D-altro-2-heptulose Basic information |
| Product Name: | D-altro-2-heptulose | | Synonyms: | D-altro-2-heptulose;(3S,4R,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one;Altro-heptulose;C02076;Volemulose;D-Sedoheptulose;D-Sedoheptulose;(3S,4R,5R,6R)-1,3,4,5,6,7-Hexahydroxyheptan-2-one (>90%) | | CAS: | 3019-74-7 | | MF: | C7H14O7 | | MW: | 210.18 | | EINECS: | 221-166-2 | | Product Categories: | | | Mol File: | 3019-74-7.mol |  |
| | D-altro-2-heptulose Chemical Properties |
| Melting point | 249 °C | | Boiling point | 628.0±55.0 °C(Predicted) | | density | 1.645±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Easily soluble (water), slightly soluble (ethanol) | | form | liquid
solid (semi solid, viscous liquid) | | pka | 11.86±0.20(Predicted) | | color | beige to very dark red-brown | | Optical Rotation | +2.5 | | BRN | 1726427 | | InChI | 1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1 | | InChIKey | HSNZZMHEPUFJNZ-SHUUEZRQSA-N | | SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO || OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | D-altro-2-heptulose Usage And Synthesis |
| Definition | ChEBI: Sedoheptulose is a ketoheptose. | | Biochem/physiol Actions | Substrate for sedoheptulose kinase CARKL directing macro-phage polarization through control of glucose metabolism. Accumulation under carbondioxide enrichment in leaves. Patients with the autosomal recessive lysosomal storage disease cystinosis have elevated urinary concentrations of sedoheptulose. |
| | D-altro-2-heptulose Preparation Products And Raw materials |
|