| Company Name: |
AnalyticsStanza Inc
|
| Tel: |
+91-7032031309 |
| Email: |
info@analyticsstanza.com |
| Products Intro: |
Product Name:Clomiphene RC A
CAS:74056-26-1
Purity:98.10 Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:Clomiphene related compound A
CAS:74056-26-1
Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-C-2863
|
|
| | 2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride Basic information |
| Product Name: | 2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride | | Synonyms: | 2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride;2-(4-(1,2Diphenylethenyl)phenoxy) diethyl ammonium chloride;Clomiphene Related Compound A (100 mg) ((E,Z)-2-[4-(1,2-diphenylethenyl)phenoxy]-N,N-diethylethanamine hydrochloride);2-[4-(1,2-diphenylethenyl)phenoxy]ethyl-diethylazanium:chloride;ENCL-006;Clomiphene Impurity A;Clomifene Citrate Impurity A as Hydrochloride;Clomiphene Related Compound A as Hydrochloride | | CAS: | 74056-26-1 | | MF: | C26H30ClNO | | MW: | 407.98 | | EINECS: | 277-686-5 | | Product Categories: | | | Mol File: | 74056-26-1.mol | ![2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride Structure](CAS/GIF/74056-26-1.gif) |
| | 2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride Chemical Properties |
| Melting point | 148-157 °C | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Beige to Brown | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C26H29NO.ClH/c1-3-27(4-2)19-20-28-25-17-15-24(16-18-25)26(23-13-9-6-10-14-23)21-22-11-7-5-8-12-22;/h5-18,21H,3-4,19-20H2,1-2H3;1H/b26-21-; | | InChIKey | VPQKHXADDASFHZ-AURQPEIRSA-N | | SMILES | Cl.N(CCOc1ccc(cc1)\C(=C/c3ccccc3)\c2ccccc2)(CC)CC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Carc. 2
STOT RE 2 Oral |
| | 2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride Usage And Synthesis |
| Uses | Deschloro Clomiphene Hydrochlorideis an analog of Clomiphene (C587025), with estrogenic activity. Also used in the preparation of antifertility agents. |
| | 2-[4-(1,2-diphenylvinyl)phenoxy]ethyl(diethyl)ammonium chloride Preparation Products And Raw materials |
|