|
|
| | ethyl 2-hydroxy-4-methylvalerate Basic information |
| Product Name: | ethyl 2-hydroxy-4-methylvalerate | | Synonyms: | Einecs 233-760-9;ethyl 2-hydroxy-4-methylvalerate;DL-2-Hydroxy-4-methylvaleric Acid Ethyl Ester;DL-Leucic Acid Ethyl Ester;Ethyl DL-2-Hydroxy-4-methylvalerate;2-Hydroxy-4-methylpentanoic acid ethyl ester;DL-Leucic Acid Ethyl Ester
Ethyl DL-2-Hydroxy-4-methylvalerate
DL-2-Hydroxy-4-methylvaleric Acid Ethyl Ester;Ethyl DL-Leucate | | CAS: | 10348-47-7 | | MF: | C8H16O3 | | MW: | 160.21 | | EINECS: | 233-760-9 | | Product Categories: | | | Mol File: | 10348-47-7.mol |  |
| | ethyl 2-hydroxy-4-methylvalerate Chemical Properties |
| Boiling point | 185 °C | | density | 0.97 | | refractive index | 1.4220 to 1.4260 | | storage temp. | Storage temp. 2-8°C | | pka | 13.21±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 100.00 %. fresh blackberry | | Odor Type | fruity | | InChI | InChI=1S/C8H16O3/c1-4-11-8(10)7(9)5-6(2)3/h6-7,9H,4-5H2,1-3H3 | | InChIKey | QRHOWVDPHIXNEN-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(O)CC(C)C | | LogP | 1.333 (est) | | CAS DataBase Reference | 10348-47-7 |
| WGK Germany | WGK 3 | | HS Code | 2918199890 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3
Eye Irrit. 2 |
| | ethyl 2-hydroxy-4-methylvalerate Usage And Synthesis |
| Uses | Ethyl2-hydroxy-4-methylpentanoate has a fruity odor and is commonly used as a flavoring agent in the food and beverage industry. In addition, it can be used as an intermediate in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. Its unique chemical properties make it an important ingredient in a variety of industrial processes, including the production of cosmetics and personal care products. | | Definition | ChEBI: Ethyl 2-hydroxy-4-methylpentanoate is a fatty acid ester. |
| | ethyl 2-hydroxy-4-methylvalerate Preparation Products And Raw materials |
|