|
|
| | 6-ethyl-1,2,3,4-tetrahydroanthraquinone Basic information |
| Product Name: | 6-ethyl-1,2,3,4-tetrahydroanthraquinone | | Synonyms: | 9,10-Anthracenedione,6-ethyl-1,2,3,4-tetrahydro-;6-ethyl-1,2,3,4-tetrahydroanthraquinone;2-Ethyl-5,6,7,8-tetrahydroanthracene-9,10-dione;2-Ethyl-5,6,7,8-tetrahydroanthraquinone;6-Ethyl-1,2,3,4-tetrahydro-9,10-anthracenedione;2-Ethyl-5,6,7,8-tetrahydro-9,10-anthraquinone;2-ethyl-5,6,7,8-tetrahydro-9,10-anthrahydroquinone;6-ETHYL-1,2,3,4-TETRAHYDROANTHRACENE-9,10-DIONE | | CAS: | 15547-17-8 | | MF: | C16H16O2 | | MW: | 240.3 | | EINECS: | 239-600-4 | | Product Categories: | | | Mol File: | 15547-17-8.mol |  |
| | 6-ethyl-1,2,3,4-tetrahydroanthraquinone Chemical Properties |
| Boiling point | 343.02°C (rough estimate) | | density | 1.0752 (rough estimate) | | refractive index | 1.6000 (estimate) | | InChI | InChI=1S/C16H16O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h7-9H,2-6H2,1H3 | | InChIKey | PXLXSNXYTNRKFR-UHFFFAOYSA-N | | SMILES | C1C2=C(C(=O)C3=C(C2=O)C=CC(CC)=C3)CCC1 | | EPA Substance Registry System | 6-Ethyl-1,2,3,4-tetrahydroanthraquinone (15547-17-8) |
| | 6-ethyl-1,2,3,4-tetrahydroanthraquinone Usage And Synthesis |
| | 6-ethyl-1,2,3,4-tetrahydroanthraquinone Preparation Products And Raw materials |
|