6-hydroxyhexan-2-one manufacturers
|
| | 6-hydroxyhexan-2-one Basic information |
| Product Name: | 6-hydroxyhexan-2-one | | Synonyms: | 6-hydroxyhexan-2-one;2-Hexanone, 6-hydroxy- (7CI,8CI,9CI);EINECS 244-622-2;4-Acetylbutyl alcohol;6-Hydroxyhexane-2-one;4-Acetyl-1-Butanol;5-Oxohexanol;Nsc 620043 | | CAS: | 21856-89-3 | | MF: | C6H12O2 | | MW: | 116.16 | | EINECS: | 244-622-2 | | Product Categories: | ACETYLGROUP | | Mol File: | 21856-89-3.mol |  |
| | 6-hydroxyhexan-2-one Chemical Properties |
| Melting point | -3.75°C (estimate) | | Boiling point | 212.22°C (estimate) | | density | 0.9200 | | refractive index | 1.4300 | | storage temp. | Storage temp. 2-8°C | | pka | 15.08±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H12O2/c1-6(8)4-2-3-5-7/h7H,2-5H2,1H3 | | InChIKey | UALYCKSVHDYQRP-UHFFFAOYSA-N | | SMILES | CC(=O)CCCCO |
| | 6-hydroxyhexan-2-one Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 35, p. 3080, 1970 DOI: 10.1021/jo00834a046 |
| | 6-hydroxyhexan-2-one Preparation Products And Raw materials |
|