- 3-Chloro-5-methylpyridazine
-
- $200.00 / 1KG
-
2025-09-25
- CAS:89283-31-8
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
- 3-chloro-5-methylpyridazine
-
- $0.00 / 1kg
-
2022-08-13
- CAS:89283-31-8
- Min. Order: 0.00009999999747378752kg
- Purity: 98%min
- Supply Ability: 100kgs/month
|
| | 3-Chloro-5-methylpyridazine Basic information |
| | 3-Chloro-5-methylpyridazine Chemical Properties |
| Melting point | 139-140 °C | | Boiling point | 259.7±20.0 °C(Predicted) | | density | 1.234±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | form | liquid | | pka | 1.91±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C5H5ClN2/c1-4-2-5(6)8-7-3-4/h2-3H,1H3 | | InChIKey | GXBWRBSCBONTKK-UHFFFAOYSA-N | | SMILES | C1(Cl)=NN=CC(C)=C1 | | CAS DataBase Reference | 89283-31-8 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HS Code | 2933998090 |
| | 3-Chloro-5-methylpyridazine Usage And Synthesis |
| | 3-Chloro-5-methylpyridazine Preparation Products And Raw materials |
|