- ASCORBYL GLUCOSIDE
-
- $150.00
-
2026-08-12
- CAS:152312-71-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10tons
|
| | potassium 2-hydroxy-4-methoxybenzoate Basic information |
| Product Name: | potassium 2-hydroxy-4-methoxybenzoate | | Synonyms: | 4-MSAK;MSAK;P-Methoxy salicylic acid potassium salt;4MS KTranexamic Acid;Benzoic acid,2-hydroxy-4-Methoxy-, potassiuM salt (1:1);4-Methoxy Salicylic Acid Potassium Salt;Potassium methoxysalicylate
Potassium 2-Hydroxy-4-methoxybenzoate
;Potassium 2-hydroxy-4-methoxybenzoate | | CAS: | 152312-71-5 | | MF: | C8H7KO4 | | MW: | 206.24 | | EINECS: | 200-001-8 | | Product Categories: | 152312-71-5;4MSK | | Mol File: | 152312-71-5.mol |  |
| | potassium 2-hydroxy-4-methoxybenzoate Chemical Properties |
| Melting point | >220°C (dec.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Cosmetics Ingredients Functions | BLEACHING | | InChI | InChI=1S/C8H8O4.K.H/c1-12-5-2-3-6(8(10)11)7(9)4-5;;/h2-4,9H,1H3,(H,10,11);; | | InChIKey | YIKFQLYFPHZLOR-UHFFFAOYSA-N | | SMILES | C(C1C=CC(OC)=CC=1O)(=O)O.[KH] | | CAS DataBase Reference | 152312-71-5 |
| | potassium 2-hydroxy-4-methoxybenzoate Usage And Synthesis |
| Uses |
4MSK (Potassium 2-hydroxy-4-methoxybenzoate) inhibits the activity of the enzyme tyrosinase, which is needed for melanin production. It can be used to lighten and balance skin tone, and reducing dark spots or age spots.
|
| | potassium 2-hydroxy-4-methoxybenzoate Preparation Products And Raw materials |
|