| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | OLEAMIDE MEA Basic information |
| | OLEAMIDE MEA Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChI | 1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h9-10,22H,2-8,11-19H2,1H3,(H,21,23)/b10-9- | | InChIKey | BOWVQLFMWHZBEF-KTKRTIGZSA-N | | SMILES | O=C(CCCCCCC/C=C\CCCCCCCC)NCCO |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | OLEAMIDE MEA Usage And Synthesis |
| Uses | Anandamide is an endocannabinoid. It acts as a ligand for cannabinoid (CB) receptors CB1 and CB2 in the brain and peripheral tissues. It is synthesized from glycerophospho-N-arachidonoylethanolamine (GP-NArE) precursor by the reaction catalyzed by glycerophosphodiesterase 1. | | Biological Activity | Anandamide plays a vital role in various processes including inflammation, pain, and appetite. |
| | OLEAMIDE MEA Preparation Products And Raw materials |
|