|
|
| | 2-Chloro-4-trifluoromethylbenzoic acid Basic information |
| Product Name: | 2-Chloro-4-trifluoromethylbenzoic acid | | Synonyms: | 2-chloro-4-(trifluoromethyl)benzoic acid;2-CHLORO-4-TRIFLUOROMETHYL BENZOIC ACID,98%;4-Carboxy-3-chlorobenzotrifluoride;BENZOIC ACID, 2-CHLORO-4-(TRIFLUOROMETHYL)-;2-Chloro-4-(trifluoromethyl)benzoic acid 97%;2-Chloro-4-(trifluoromethyl)benzoicacid,97% | | CAS: | 23228-45-7 | | MF: | C8H4ClF3O2 | | MW: | 224.56 | | EINECS: | | | Product Categories: | | | Mol File: | 23228-45-7.mol |  |
| | 2-Chloro-4-trifluoromethylbenzoic acid Chemical Properties |
| Melting point | 114-117℃ | | Boiling point | 255 °C | | density | 1.523 | | Fp | 108 °C | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.33±0.25(Predicted) | | form | crystals | | color | Large white | | InChI | InChI=1S/C8H4ClF3O2/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14/h1-3H,(H,13,14) | | InChIKey | DTIJZEUKFYGSEC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(C(F)(F)F)C=C1Cl | | CAS DataBase Reference | 23228-45-7 |
| | 2-Chloro-4-trifluoromethylbenzoic acid Usage And Synthesis |
| Chemical Properties | colorless or light yellow liquid |
| | 2-Chloro-4-trifluoromethylbenzoic acid Preparation Products And Raw materials |
|