Unii-02137X034H manufacturers
- (4R,9S)-AG 205
-
- $2500.00
-
2026-05-11
- CAS:1375078-57-1
- Purity:
- Supply Ability: 10g
|
| | Unii-02137X034H Basic information |
| Product Name: | Unii-02137X034H | | Synonyms: | Unii-02137X034H;Ethanone, 2-[[1-(4-chlorophenyl)-1H-tetrazol-5-yl]thio]-1-[(4aR,9bS)-1,2,3,4,4a,9b-hexahydro-2,8-dimethyl-5H-pyrido[4,3-b]indol-5-yl]-;（4R，9S)-AG 205 | | CAS: | 1375078-57-1 | | MF: | C22H23ClN6OS | | MW: | 454.98 | | EINECS: | | | Product Categories: | | | Mol File: | 1375078-57-1.mol |  |
| | Unii-02137X034H Chemical Properties |
| Boiling point | 671.5±65.0 °C(Predicted) | | density | 1.46±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >9mg/mL (warmed) | | pka | 9.12±0.20(Predicted) | | form | powder | | color | off-white to brown | | InChIKey | GJNBAISSZRNGTM-UYAOXDASSA-N | | SMILES | CN1CC[C@@H]2[C@H](C1)c3cc(C)ccc3N2C(=O)CSc4nnnn4-c5ccc(Cl)cc5 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Unii-02137X034H Usage And Synthesis |
| Uses | AG-205 has been used to investigate the neuroprotective effects of norgestrel on stressed photoreceptors. It has also been used to study the effect of blocking progesterone receptor membrane component 1 in 661W cells. | | Biological Activity | AG-205 is a Pgrmc1 (progesterone receptor membrane component 1) inhibitor. AG-205 alters the spectroscopic properties of the Pgrmc1-heme complex. AG-205 inhibits cancer cell viability and cancer cell progression. acting preferentially on Pgrmc1-expressing cells.', 'Pgrmc1 is a cytochrome associated protein. It is found to be upregulated in several cancer types such as breast, lung and gastric cancer. Pgrmc1 regulates the epidermal growth factor signaling. |
| | Unii-02137X034H Preparation Products And Raw materials |
|