Lithium-p-styrenesulfonate manufacturers
|
| | Lithium-p-styrenesulfonate Basic information |
| Product Name: | Lithium-p-styrenesulfonate | | Synonyms: | Lithium-p-styrenesulfonate;Lithium 4-ethenylbenzene-1-sulfonate;lithium 4-vinylbenzenesulfonate;Benzenesulfonic acid, 4-ethenyl-, lithium salt (1:1);LIthium P-Styrene SuIfonate(LSS);Lithium styrene sulfonate;Benzenesulfonic Acid Impurity 121 | | CAS: | 4551-88-6 | | MF: | C8H9LiO3S | | MW: | 192.16 | | EINECS: | | | Product Categories: | | | Mol File: | 4551-88-6.mol |  |
| | Lithium-p-styrenesulfonate Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen, away from moisture | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H8O3S.Li.H/c1-2-7-3-5-8(6-4-7)12(9,10)11;;/h2-6H,1H2,(H,9,10,11);; | | InChIKey | JLVVIWWJSZMEFL-UHFFFAOYSA-N | | SMILES | S(C1C=CC(C=C)=CC=1)(O)(=O)=O.[LiH] |
| | Lithium-p-styrenesulfonate Usage And Synthesis |
| | Lithium-p-styrenesulfonate Preparation Products And Raw materials |
|