|
|
| | Iron(II) gluconate hydrate Basic information |
| Product Name: | Iron(II) gluconate hydrate | | Synonyms: | Iron(II) D-gluconate hydrate;GLUCONICACIDFERROUSSALT(HYDRATE);D-g luconic acid iron(II) salt hydrate;Ferrous gluconate xhydrate;Iron(II) D-glucote hydrate | | CAS: | 699014-53-4 | | MF: | (C6H11O7)2Feaq | | MW: | 0 | | EINECS: | 206-076-3 | | Product Categories: | | | Mol File: | 699014-53-4.mol |  |
| | Iron(II) gluconate hydrate Chemical Properties |
| form | Solid | | color | Light yellow to brown | | Merck | 13,4081 | | BRN | 3805721 | | InChI | 1S/2C6H12O7.Fe.H2O/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;;/h2*2-5,7-11H,1H2,(H,12,13);;1H2/q;;+2;/p-2/t2*2-,3-,4+,5-;;/m11../s1 | | InChIKey | BJBSKTPEFSQVHL-XRDLMGPZSA-L | | SMILES | [H]O[H].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O[Fe]OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | LZ5150000 | | Storage Class | 11 - Combustible Solids |
| | Iron(II) gluconate hydrate Usage And Synthesis |
| Uses | Iron(II) gluconate is a kind of biochemical reagent. | | References | [1] Bergmeyer, et al. "Biochemical reagents." Methods of Enzymatic Analysis. Academic Press, 1965. 967-1037. |
| | Iron(II) gluconate hydrate Preparation Products And Raw materials |
|