Benzenamine, 3-bromo-4,5-dichloro-N,N-diphenyl- manufacturers
|
| | Benzenamine, 3-bromo-4,5-dichloro-N,N-diphenyl- Basic information |
| Product Name: | Benzenamine, 3-bromo-4,5-dichloro-N,N-diphenyl- | | Synonyms: | Benzenamine, 3-bromo-4,5-dichloro-N,N-diphenyl-;3-Bromo-4,5-dichloro-N,N-diphenylbenzenamine;3-Bromo-4,5-dichloro-N,N-diphenylaniline | | CAS: | 2307629-51-0 | | MF: | C18H12BrCl2N | | MW: | 393.1 | | EINECS: | | | Product Categories: | | | Mol File: | 2307629-51-0.mol |  |
| | Benzenamine, 3-bromo-4,5-dichloro-N,N-diphenyl- Chemical Properties |
| Boiling point | 483.9±45.0 °C(Predicted) | | density | 1.507±0.06 g/cm3(Predicted) | | pka | -5.41±0.50(Predicted) | | InChI | InChI=1S/C18H12BrCl2N/c19-16-11-15(12-17(20)18(16)21)22(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H | | InChIKey | GYUNGNDFZGGCNF-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=CC=C2)C2=CC=CC=C2)=CC(Cl)=C(Cl)C(Br)=C1 |
| | Benzenamine, 3-bromo-4,5-dichloro-N,N-diphenyl- Usage And Synthesis |
| | Benzenamine, 3-bromo-4,5-dichloro-N,N-diphenyl- Preparation Products And Raw materials |
|