| Company Name: |
Nanjing ShinGen PharmTech Co.，Ltd Gold
|
| Tel: |
15365085396 |
| Email: |
523576380@qq.com |
| Products Intro: |
Product Name:7-Bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)quinazoline
CAS:2134618-53-2
Purity:97% Package:1g;5g
|
| Company Name: |
Yutong Pharmaceutical Technology (Suzhou) Co., Ltd. Gold
|
| Tel: |
0512-15851462628 15851462628 |
| Email: |
2680463261@qq.com |
| Products Intro: |
Product Name:Quinazoline, 7-bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)
CAS:2134618-53-2
Purity:95%-99% Package:1g;100g
|
| Company Name: |
Shanghai Haohong Scientific Co., Ltd. Gold
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:7-Bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)quinazoline
CAS:2134618-53-2
Purity:95%
|
| Company Name: |
Hebei Summedchem Co.,Ltd
|
| Tel: |
0319-5801333-8008 15630992918 |
| Email: |
sales@summedchem.com |
| Products Intro: |
Product Name:7-Bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)quinazoline
CAS:2134618-53-2
Purity:98% Package:1G;25G;100G;500G;1KG;10KG;100KG;1005KG
|
|
| | Quinazoline, 7-bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)- Basic information |
| | Quinazoline, 7-bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)- Chemical Properties |
| Boiling point | 324.6±42.0 °C(Predicted) | | density | 1.937±0.06 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | pka | -3.15±0.30(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C9HBrCl2F4N2/c10-4-3(9(14,15)16)1-2-6(5(4)13)17-8(12)18-7(2)11/h1H | | InChIKey | WWIVWNJCWQRAFT-UHFFFAOYSA-N | | SMILES | N1=C2C(C=C(C(F)(F)F)C(Br)=C2F)=C(Cl)N=C1Cl |
| | Quinazoline, 7-bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)- Usage And Synthesis |
| | Quinazoline, 7-bromo-2,4-dichloro-8-fluoro-6-(trifluoromethyl)- Preparation Products And Raw materials |
|