- Purvalanol B
-
- $65.00 / 5mg
-
2026-01-05
- CAS:212844-54-7
- Min. Order:
- Purity: 98.00%
- Supply Ability: 10g
|
| | (2R)-2-[[6-[(3-CHLORO-4-CARBOXYPHENYL)AMINO]-9-(1-METHYLETHYL)-9H-PURIN-2-YL]AMINO]-3-METHYL-1-BUTANOL Basic information |
| Product Name: | (2R)-2-[[6-[(3-CHLORO-4-CARBOXYPHENYL)AMINO]-9-(1-METHYLETHYL)-9H-PURIN-2-YL]AMINO]-3-METHYL-1-BUTANOL | | Synonyms: | (2R)-2-[[6-[(3-CHLORO-4-CARBOXYPHENYL)AMINO]-9-(1-METHYLETHYL)-9H-PURIN-2-YL]AMINO]-3-METHYL-1-BUTANOL;PURVALANOL B;NG 95;(2R)-2-((6-((3-Chloro-4-carboxyphenyl)amino)-9-(1-methylethyl)-9H-purin-2-yl)amino)-3-methyl-1-butanol;NG 95, (2R)-2-[[6-[(3-Chloro-4-carboxyphenyl)amino]-9-(1-methylethyl)-9H-purin-2-yl]amino]-3-methyl-1-butanol;Purvalanol B, >=96%;(R)-2-Chloro-4-((2-((1-hydroxy-3-methylbutan-2-yl)amino)-9-isopropyl-9H-purin-6-yl)amino)benzo;Purvalanol B(NG 95) | | CAS: | 212844-54-7 | | MF: | C20H25ClN6O3 | | MW: | 432.9 | | EINECS: | | | Product Categories: | Signalling | | Mol File: | 212844-54-7.mol | ![(2R)-2-[[6-[(3-CHLORO-4-CARBOXYPHENYL)AMINO]-9-(1-METHYLETHYL)-9H-PURIN-2-YL]AMINO]-3-METHYL-1-BUTANOL Structure](CAS/GIF/212844-54-7.gif) |
| | (2R)-2-[[6-[(3-CHLORO-4-CARBOXYPHENYL)AMINO]-9-(1-METHYLETHYL)-9H-PURIN-2-YL]AMINO]-3-METHYL-1-BUTANOL Chemical Properties |
| Melting point | 58.5 °C | | Boiling point | 660.6±65.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO: 37 mg/mL, soluble | | pka | 2.81±0.25(Predicted) | | form | solid | | color | White to light yellow | | InChIKey | ZKDXRFMOHZVXSG-HNNXBMFYSA-N | | SMILES | CC(C)[C@H](CO)Nc1nc(Nc2ccc(C(O)=O)c(Cl)c2)c3ncn(C(C)C)c3n1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (2R)-2-[[6-[(3-CHLORO-4-CARBOXYPHENYL)AMINO]-9-(1-METHYLETHYL)-9H-PURIN-2-YL]AMINO]-3-METHYL-1-BUTANOL Usage And Synthesis |
| Description | Cyclin-dependent kinases (CDKs) are key regulators of cell cycle progression and are therefore promising targets for cancer therapy. Purvalanol B is a CDK inhibitor that most potently inhibits Cdk2/cyclin A, Cdk2/cyclin E, Cdk5/p35, and Cdk2/cyclin B (IC50s = 6, 9, 6, and 6 nM, respectively). It is inactive against Cdk4/cyclin D1 as well as several other protein kinases. Purvalanol B is a 2,6,9-trisubstituted purine that, at micromolar doses, inhibits the growth of parasites, including Plasmodium. | | Uses | Cyclin-dependent kinases (CDKs) are key regulators of cell cycle progression and are therefore promising targets for cancer therapy. Purvalanol B is a CDK inhibitor that most potently inhibits Cdk2/cyclin A, Cdk2/cyclin E, Cdk5/p35, and Cdk2/cyclin B (IC50s = 6, 9, 6, and 6 nM, respectively). It is inactive against Cdk4/cyclin D1 as well as several other protein kinases. Purvalanol B is a 2,6,9-trisubstituted purine that, at micromolar doses, inhibits the growth of parasites, including Plasmodium. | | Uses | Purvalanol B is a potent cyclin-dependent kinase 2 (CDK2) inhibitor. These cyclin-dependent kinases play key roles in the regulation of the cell cycle and small molecules that inhibit these proteins have therapeutic potential against various proliferative and neurodegenerative disorders. | | Definition | ChEBI: Purvalanol B is a purvalanol. It has a role as a protein kinase inhibitor. | | Biological Activity | Cyclin-dependent kinase inhibitor. IC 50 values are 6, 6, 9, > 10,000, and 6 nM for cdc2/cyclin B, cdk2/cyclin A, cdk2/cyclin E, cdk4/cyclin D1 and cdk5-p35 respectively. Selective over a range of other protein kinases (IC 50 > 10,000 nM). Shown to have antiproliferative properties, mediated by p42/p44 MAPK. | | storage | Store at +4°C | | References | [1] SERA T. [Exploiting chemical libraries, structure, and genomics in the search for kinase inhibitors].[J]. Tanpakushitsu kakusan koso. Protein, nucleic acid, enzyme, 2007, 52 13 Suppl: 1812-1813.
[2] M KNOCKAERT. Intracellular targets of cyclin-dependent kinase inhibitors: identification by affinity chromatography using immobilised inhibitors.[J]. Chemistry & biology, 2000, 7 6: 411-422. DOI: 10.1016/s1074-5521(00)00124-1
[3] KRISTEN M BULLARD Susan M K Carolyn Broccardo. Effects of cyclin-dependent kinase inhibitor Purvalanol B application on protein expression and developmental progression in intra-erythrocytic Plasmodium falciparum parasites.[J]. Malaria Journal, 2015: 147. DOI: 10.1186/s12936-015-0655-x |
| | (2R)-2-[[6-[(3-CHLORO-4-CARBOXYPHENYL)AMINO]-9-(1-METHYLETHYL)-9H-PURIN-2-YL]AMINO]-3-METHYL-1-BUTANOL Preparation Products And Raw materials |
|