|
|
| | (R)-(+)-a,a-Diphenyl-2-pyrrolidinemethanol Basic information |
| Product Name: | (R)-(+)-a,a-Diphenyl-2-pyrrolidinemethanol | | Synonyms: | 2-PYRROLIDINEMETHANOL, A,A-DIPHENYL-;2-Pyrrolidinemethanol, α,α-diphenyl-, (2R)-;(2R)-α,α-diphenyl-2-Pyrrolidinemethanol;(R)-1-DIPHENYL-PROLINOL;(R)-(+)-2-(DIPHENYLHYDROXYMETHYL)-PYRROLIDIN;(R)-2-(DIPHENYLHYDROXYMETHYL)PYRROLIDINE;(R)-(+)-ɑ,ɑ-Diphenylprolinol, 99%;ALPHA,ALPHA-DIPHENYL-D-PROLINOL | | CAS: | 22348-32-9 | | MF: | C17H19NO | | MW: | 253.35 | | EINECS: | 606-992-7 | | Product Categories: | Chiral Reagent;Chiral Reagents;CHIRAL COMPOUNDS;pharmacetical;chiral;CHIRAL CHEMICALS;Chiral chemicals;Peptide;Asymmetric Synthesis;Chiral Building Blocks;Simple Alcohols (Chiral);Synthetic Organic Chemistry;Benzenes;Pharmaceutical intermediate | | Mol File: | 22348-32-9.mol |  |
| | (R)-(+)-a,a-Diphenyl-2-pyrrolidinemethanol Chemical Properties |
| Melting point | 77-80 °C | | alpha | 59 º (589nm, c=3, MeOH 25 ºC) | | Boiling point | 396.54°C (rough estimate) | | density | 1.0078 (rough estimate) | | refractive index | 58 ° (C=2, MeOH) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | almost transparency in Chloroform | | form | solid | | pka | 13.15±0.29(Predicted) | | color | white to off-white | | Optical Rotation | [α]20/D +69°, c = 3 in chloroform | | BRN | 4353363 | | InChI | 1S/C17H19NO/c19-17(16-12-7-13-18-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,18-19H,7,12-13H2/t16-/m1/s1 | | InChIKey | OGCGXUGBDJGFFY-MRXNPFEDSA-N | | SMILES | OC([C@H]1CCCN1)(c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 22348-32-9(CAS DataBase Reference) | | NIST Chemistry Reference | (R)-alpha-(2-pyrrolidinyl)benzhydryl alcohol(22348-32-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 10-34 | | TSCA | No | | HS Code | 29221990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(+)-a,a-Diphenyl-2-pyrrolidinemethanol Usage And Synthesis |
| Chemical Properties | white to faintly yellow crystalline powder | | Uses | suzuki reaction | | Uses | Used to prepare the corresponding oxazaborolidines for the borane-mediated asymmetric reduction of ketones. | | Definition | ChEBI: (r)-alpha,alpha-diphenyl-2-pyrrolidinemethanol is a diarylmethane. | | Synthesis | Draw 14 kg of tetrahydrofuran into the reaction kettle. 61.5 kg of a 34% strength solution of phenylmagnesium chloride in tetrahydrofuran was added to the reaction vessel to initiate agitation and cooling cycles. The control temperature is 10 to 60 °C. The dropping time was controlled for 5 to 6 hours, and stirring was continued for 1 hour. Pump 24 kg of concentrated hydrochloric acid (mass concentration 36%) into the matching drip tank of the reaction kettle. constantly dropping, the dropping time is controlled for 1 hour, and the dropping process control temperature does not exceed 45 ° C. After the addition was completed, stirring was continued for 8 hours.Cool down to -5 ° C ~ 5 ° C to obtain (R)-(+)-a,a-Diphenyl-2-pyrrolidinemethanol, a total of 17.2 kg, yield 85%. |
| | (R)-(+)-a,a-Diphenyl-2-pyrrolidinemethanol Preparation Products And Raw materials |
|