| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
IL-1R Antagonist manufacturers
- TLR1
-
- $51.00
-
2026-07-27
- CAS:566914-00-9
- Purity: 98.70%
- Supply Ability: 10g
- TLR1
-
- $51.00
-
2026-07-27
- CAS:566914-00-9
- Purity: 98.70%
- Supply Ability: 10g
|
| | IL-1R Antagonist Basic information |
| Product Name: | IL-1R Antagonist | | Synonyms: | IL-1R Antagonist;Benzenepropanamide, N-[(1S)-2-methyl-1-(1-pyrrolidinylcarbonyl)propyl]-;(S)-N-(3-Methyl-1-oxo-1-(pyrrolidin-1-yl)butan-2-yl)-3-phenylpropanamide;Benzenepropanamide, N-[(1S)-2-methyl-1-(pyrrolidinylcarbonyl)propyl]-;N-[(2S)-3-Methyl-1-oxo-1-(1-pyrrolidinyl)-2-butanyl]-3-phenylpropanamide;IL-1R antagonist(TLR1);TLR1,TLR-1,TLR 1,Inhibitor,MyD88,inhibit;I912552 IL-1R Antagonist,98% | | CAS: | 566914-00-9 | | MF: | C18H26N2O2 | | MW: | 302.41 | | EINECS: | | | Product Categories: | | | Mol File: | 566914-00-9.mol |  |
| | IL-1R Antagonist Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 0.5 mg/ml | | form | Liquid | | color | Colorless to light yellow | | InChI | 1S/C18H26N2O2/c1-14(2)17(18(22)20-12-6-7-13-20)19-16(21)11-10-15-8-4-3-5-9-15/h3-5,8-9,14,17H,6-7,10-13H2,1-2H3,(H,19,21)/t17-/m0/s1 | | InChIKey | DAZSWUUAFHBCGE-KRWDZBQOSA-N | | SMILES | N2(CCCC2)C(=O)[C@@H](NC(=O)CCc1ccccc1)C(C)C |
| WGK Germany | WGK 1 | | Storage Class | 10 - Combustible liquids |
| | IL-1R Antagonist Usage And Synthesis |
| Uses | TLR1 (compound 4a) is a low molecular weight, cell-penetrating Toll/IL-1 receptor/resistance (TIR) domain/BB-Loop mimic. TLR1 inhibits IL-1 receptor-mediated responses[1]. | | Biological Activity | Cell permeable: yes', 'Primary Target
TIR domain-mediated MyD88/IL1-RI interaction', 'Product does not compete with ATP.', 'Reversible: no | | in vivo | TLR1 interferes with the interactions between mouse MyD88 and IL-1RI at the TIR domains. TLR1 produces a significant attenuation of the IL-1β-induced fever response (200 mg/kg, i.p.)[1]. | | References | [1] Bartfai T, et al. A low molecular weight mimic of the Toll/IL-1 receptor/resistance domain inhibits IL-1 receptor-mediated responses. Proc Natl Acad Sci U S A. 2003 Jun 24;100(13):7971-6. DOI:10.1073/pnas.0932746100 |
| | IL-1R Antagonist Preparation Products And Raw materials |
|