- Methyl 5-nitroisophthalate
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1955-46-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Methyl 5-nitroisophthalate Basic information |
| Product Name: | Methyl 5-nitroisophthalate | | Synonyms: | NITROISOPHTHALIC-5 ACID, MONOMETHYL ESTER;MONO-METHYL 5-NITROISOPHTHALATE;MONO-METHYL-5-NITROISOPHTHALIC ACID;3-benzenedicarboxylicacid,5-nitro-monomethylester;5-Nirto-iso-phthalicacidmonomethylester;METHYL HYDROGEN 5-NITROISOPHTHALATE;Methyl 5-nitroisophthalate;LABOTEST-BB LT00848268 | | CAS: | 1955-46-0 | | MF: | C9H7NO6 | | MW: | 225.15 | | EINECS: | 217-793-6 | | Product Categories: | Phthalic Acids, Esters and Derivatives | | Mol File: | 1955-46-0.mol |  |
| | Methyl 5-nitroisophthalate Chemical Properties |
| Melting point | 180-182 °C (lit.) | | Boiling point | 366.65°C (rough estimate) | | density | 1.5322 (rough estimate) | | vapor pressure | 0-0Pa at 25℃ | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 9g/L in organic solvents at 20 ℃ | | pka | 3.11±0.10(Predicted) | | form | Fine Crystalline Powder | | color | Slightly yellow | | Water Solubility | insoluble | | BRN | 1469253 | | InChI | 1S/C9H7NO6/c1-16-9(13)6-2-5(8(11)12)3-7(4-6)10(14)15/h2-4H,1H3,(H,11,12) | | InChIKey | ZCRNIIJXDRYWDU-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(cc(c1)[N+]([O-])=O)C(O)=O | | LogP | 1.65 at 25℃ | | CAS DataBase Reference | 1955-46-0(CAS DataBase Reference) | | EPA Substance Registry System | Monomethyl 5-nitroisophthalate (1955-46-0) |
| | Methyl 5-nitroisophthalate Usage And Synthesis |
| Chemical Properties | SLIGHTLY YELLOW FINE CRYSTALLINE POWDER | | Uses | Methyl 5-nitroisophthalate is used in the preparation of heterotrifunctional crosslinkers for multiple bioconjugation with peptides and also in the synthesis of histone demethylase LSD1 inhibitors tha
t target cancer cells. | | Uses | mono-Methyl 5-nitroisophthalate has been used as starting reagent in the synthesis of 3-amide-5-[(dipropylamino)carbonyl]benzoic acids. | | Flammability and Explosibility | Non flammable |
| | Methyl 5-nitroisophthalate Preparation Products And Raw materials |
|