|
|
| | 3-Phenyl-L-serine Basic information |
| Product Name: | 3-Phenyl-L-serine | | Synonyms: | (2S,3R)-3-PHENYLSERINE;3-phenyl-L-serine;L-Threo-3-Phenylserine;(2S,3R)-2-Amino-3-hydroxy-3-phenylpropanoic acid;(2S,3R)-2-Amino-3-hydroxy-3-phenylpropionic acid;(2S,3R)-2-Amino-3-phenyl-3-hydroxypropionic acid;(3R)-3-Phenyl-L-serine;(3R)-3-Phenylserine | | CAS: | 6254-48-4 | | MF: | C9H11NO3 | | MW: | 181.19 | | EINECS: | 228-383-1 | | Product Categories: | Antibiotics | | Mol File: | 6254-48-4.mol |  |
| | 3-Phenyl-L-serine Chemical Properties |
| Melting point | 178-181°C | | storage temp. | Refrigerator | | solubility | Acetonitrile (Slightly), Methanol (Sparingly), Water (Sparingly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C9H11NO3/c10-7(9(12)13)8(11)6-4-2-1-3-5-6/h1-5,7-8,11H,10H2,(H,12,13)/t7-,8+/s3 | | InChIKey | VHVGNTVUSQUXPS-WWXSATIUNA-N | | SMILES | C1(C=CC=CC=1)[C@@H](O)[C@H](N)C(=O)O |&1:6,8,r| | | CAS DataBase Reference | 6254-48-4 |
| | 3-Phenyl-L-serine Usage And Synthesis |
| Uses | L-threo-Phenylserine is a valuable chiral synthon. | | Definition | ChEBI: A L-phenylalanine derivative carrying a hydroxy substituent at position 3. |
| | 3-Phenyl-L-serine Preparation Products And Raw materials |
|