| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:L-(+)-Ribulose
CAS:2042-27-5
Purity:98% Remarks:5028
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:(3S,4S)-1,3,4,5-tetrahydroxypentan-2-one
CAS:2042-27-5
Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
|
| | L-erythro-2-Pentulose (9CI) Basic information |
| | L-erythro-2-Pentulose (9CI) Chemical Properties |
| Fp | >113℃ | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Oil | | color | Yellow | | Optical Rotation | [α]/D +14.5±3.0°, c = 0.1 in H2O | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChI | 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5-/m0/s1 | | InChIKey | ZAQJHHRNXZUBTE-UCORVYFPSA-N | | SMILES | OC[C@H](O)[C@H](O)C(=O)CO |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | L-erythro-2-Pentulose (9CI) Usage And Synthesis |
| Uses | L-Ribulose is a rare sugar produced mainly from the abundant L-arabinose via enzymatic conversion. | | Definition | ChEBI: L-ribulose is a ribulose. It has a role as an Escherichia coli metabolite. | | IC 50 | Human Endogenous Metabolite |
| | L-erythro-2-Pentulose (9CI) Preparation Products And Raw materials |
|