|
|
| | Trimethylmethanetricarboxylate Basic information |
| Product Name: | Trimethylmethanetricarboxylate | | Synonyms: | methanetricarboxylic acid trimethyl ester;Methanetricarboxylic acid 1,1,1-trimethyl ester;Tricarbomethoxymethane;Trimethylmethanetricarboxylate;2-methylpropane-1,1,1-tricarboxylate | | CAS: | 1186-73-8 | | MF: | C7H10O6 | | MW: | 190.15 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 1186-73-8.mol |  |
| | Trimethylmethanetricarboxylate Chemical Properties |
| Melting point | 46.5°C | | Boiling point | 242.7°C (estimate) | | density | 1.3328 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | 2-8°C | | pka | 8.09±0.46(Predicted) | | Appearance | Colorless to off-white Solid | | InChI | InChI=1S/C7H10O6/c1-11-5(8)4(6(9)12-2)7(10)13-3/h4H,1-3H3 | | InChIKey | BNOIMFITGLLJTH-UHFFFAOYSA-N | | SMILES | C(C(=O)OC)(C(=O)OC)C(=O)OC |
| | Trimethylmethanetricarboxylate Usage And Synthesis |
| | Trimethylmethanetricarboxylate Preparation Products And Raw materials |
|