| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Isopropylamino-3-nitro-benzoic acid methyl ester Basic information |
| | 4-Isopropylamino-3-nitro-benzoic acid methyl ester Chemical Properties |
| Boiling point | 377.2±32.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | pka | -2.60±0.50(Predicted) | | form | solid | | InChI | 1S/C11H14N2O4/c1-7(2)12-9-5-4-8(11(14)17-3)6-10(9)13(15)16/h4-7,12H,1-3H3 | | InChIKey | KDBFIMHBQVKQTJ-UHFFFAOYSA-N | | SMILES | O=[N+](C1=C(NC(C)C)C=CC(C(OC)=O)=C1)[O-] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 4-Isopropylamino-3-nitro-benzoic acid methyl ester Usage And Synthesis |
| | 4-Isopropylamino-3-nitro-benzoic acid methyl ester Preparation Products And Raw materials |
|