| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Products Intro: |
Product Name:Cyclohexane-1,1,2,2,3,3,4,4,5,5,6-d11,6-(methyl-d3)-
CAS:10120-28-2
Purity:99.5 atom % D
|
|
|
|
|
Methylcyclohexane-d14 manufacturers
- METHYLCYCLOHEXANE-D14
-
- $15.00 / 1KG
-
2021-08-12
- CAS:10120-28-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Methylcyclohexane-d14 Basic information |
| | Methylcyclohexane-d14 Chemical Properties |
| Melting point | -126 °C | | Melting point | -126°C | | Boiling point | 101°C | | Boiling point | 101 °C | | density | d= 0,88 | | density | 0.88 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4189(lit.) | | Fp | 25 °F | | storage temp. | Flammables area | | solubility | 0.1g/l | | form | Liquid | | color | Clear colorless | | Appearance | Clear colorless liquid | | explosive limit | 1.1-6.7%(V) | | InChI | InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D | | InChIKey | UAEPNZWRGJTJPN-OBYKGMMLSA-N | | SMILES | C([2H])([2H])([2H])C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] | | CAS DataBase Reference | 10120-28-2(CAS DataBase Reference) | | EPA Substance Registry System | Methylcyclohexane-d14 (10120-28-2) |
| Hazard Codes | F,Xi,N,Xn | | Risk Statements | 11-67-65-51/53-38 | | Safety Statements | 9-16-33-62-61 | | RIDADR | UN 2296 3/PG 2 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | II | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | Methylcyclohexane-d14 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | NMR Solvents |
| | Methylcyclohexane-d14 Preparation Products And Raw materials |
|